C10H12N2OS — CID 13015436
3-(benzenecarbonothioyl)-1,1-dimethylurea (PubChem CID 13015436) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-(benzenecarbonothioyl)-1,1-dimethylurea.
| Compound Name | 3-(benzenecarbonothioyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 13015436 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-(benzenecarbonothioyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(=S)c1ccccc1 |
| InChI | InChI=1S/C10H12N2OS/c1-12(2)10(13)11-9(14)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,11,13,14) |
| InChIKey | QZBZQCRPLIJISK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|