C19H19NOS2 — CID 141320839
2-(benzenecarbonothioyl)-N,N,2-trimethyl-3-phenyl-3-sulfanylidenepropanamide (PubChem CID 141320839) has the molecular formula C19H19NOS2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-(benzenecarbonothioyl)-N,N,2-trimethyl-3-phenyl-3-sulfanylidenepropanamide.
| Compound Name | 2-(benzenecarbonothioyl)-N,N,2-trimethyl-3-phenyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 141320839 |
| Molecular Formula | C19H19NOS2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-(benzenecarbonothioyl)-N,N,2-trimethyl-3-phenyl-3-sulfanylidenepropanamide |
| SMILES | CN(C)C(=O)C(C)(C(=S)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C19H19NOS2/c1-19(18(21)20(2)3,16(22)14-10-6-4-7-11-14)17(23)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | KHELJNUJGRWJQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|