C13H16OS — CID 21113703
4,4-dimethyl-1-phenyl-3-sulfanylidenepentan-1-one (PubChem CID 21113703) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenyl-3-sulfanylidenepentan-1-one.
| Compound Name | 4,4-dimethyl-1-phenyl-3-sulfanylidenepentan-1-one |
|---|---|
| PubChem CID | 21113703 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4,4-dimethyl-1-phenyl-3-sulfanylidenepentan-1-one |
| SMILES | CC(C)(C)C(=S)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16OS/c1-13(2,3)12(15)9-11(14)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | HZFPVVMFLJLPMP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|