C28H30N2O4 — CID 88616895
4,4-dimethyl-3-oxo-N-phenylpentanamide;3-oxo-N,3-diphenylpropanamide (PubChem CID 88616895) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 4,4-dimethyl-3-oxo-N-phenylpentanamide;3-oxo-N,3-diphenylpropanamide.
| Compound Name | 4,4-dimethyl-3-oxo-N-phenylpentanamide;3-oxo-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 88616895 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 4,4-dimethyl-3-oxo-N-phenylpentanamide;3-oxo-N,3-diphenylpropanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)Nc1ccccc1.O=C(CC(=O)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C15H13NO2.C13H17NO2/c17-14(12-7-3-1-4-8-12)11-15(18)16-13-9-5-2-6-10-13;1-13(2,3)11(15)9-12(16)14-10-7-5-4-6-8-10/h1-10H,11H2,(H,16,18);4-8H,9H2,1-3H3,(H,14,16) |
| InChIKey | GQJVOQSLTHHXJQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|