C22H21N5O2S2 — CID 24938048
3-N',4-N'-bis(benzenecarbonothioyl)-3-N',4-N'-dimethyl-1H-pyrrole-3,4-dicarbohydrazide (PubChem CID 24938048) has the molecular formula C22H21N5O2S2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 3-N',4-N'-bis(benzenecarbonothioyl)-3-N',4-N'-dimethyl-1H-pyrrole-3,4-dicarbohydrazide.
| Compound Name | 3-N',4-N'-bis(benzenecarbonothioyl)-3-N',4-N'-dimethyl-1H-pyrrole-3,4-dicarbohydrazide |
|---|---|
| PubChem CID | 24938048 |
| Molecular Formula | C22H21N5O2S2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 3-N',4-N'-bis(benzenecarbonothioyl)-3-N',4-N'-dimethyl-1H-pyrrole-3,4-dicarbohydrazide |
| SMILES | CN(NC(=O)c1c[nH]cc1C(=O)NN(C)C(=S)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C22H21N5O2S2/c1-26(21(30)15-9-5-3-6-10-15)24-19(28)17-13-23-14-18(17)20(29)25-27(2)22(31)16-11-7-4-8-12-16/h3-14,23H,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | RYLHWHWMFJUPQS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|