C17H19N5O3S3 — CID 87484183
1-[benzenecarbonothioyl(methyl)amino]-3-[[benzenecarbonothioyl(methyl)amino]sulfamoyl]urea (PubChem CID 87484183) has the molecular formula C17H19N5O3S3 and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[benzenecarbonothioyl(methyl)amino]-3-[[benzenecarbonothioyl(methyl)amino]sulfamoyl]urea.
| Compound Name | 1-[benzenecarbonothioyl(methyl)amino]-3-[[benzenecarbonothioyl(methyl)amino]sulfamoyl]urea |
|---|---|
| PubChem CID | 87484183 |
| Molecular Formula | C17H19N5O3S3 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-[benzenecarbonothioyl(methyl)amino]-3-[[benzenecarbonothioyl(methyl)amino]sulfamoyl]urea |
| SMILES | CN(NC(=O)NS(=O)(=O)NN(C)C(=S)c1ccccc1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C17H19N5O3S3/c1-21(15(26)13-9-5-3-6-10-13)18-17(23)19-28(24,25)20-22(2)16(27)14-11-7-4-8-12-14/h3-12,20H,1-2H3,(H2,18,19,23) |
| InChIKey | FHYOTQUAFAEQFT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|