C23H24N4O4S2 — CID 24937925
2-N',6-N'-bis(benzenecarbonothioyl)-2-N',6-N'-dimethyl-4-oxooxane-2,6-dicarbohydrazide (PubChem CID 24937925) has the molecular formula C23H24N4O4S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-N',6-N'-bis(benzenecarbonothioyl)-2-N',6-N'-dimethyl-4-oxooxane-2,6-dicarbohydrazide.
| Compound Name | 2-N',6-N'-bis(benzenecarbonothioyl)-2-N',6-N'-dimethyl-4-oxooxane-2,6-dicarbohydrazide |
|---|---|
| PubChem CID | 24937925 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-N',6-N'-bis(benzenecarbonothioyl)-2-N',6-N'-dimethyl-4-oxooxane-2,6-dicarbohydrazide |
| SMILES | CN(NC(=O)C1CC(=O)CC(C(=O)NN(C)C(=S)c2ccccc2)O1)C(=S)c1ccccc1 |
| InChI | InChI=1S/C23H24N4O4S2/c1-26(22(32)15-9-5-3-6-10-15)24-20(29)18-13-17(28)14-19(31-18)21(30)25-27(2)23(33)16-11-7-4-8-12-16/h3-12,18-19H,13-14H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | HLPKARZPXMJVMO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|