C21H23N4O5S3+ — CID 91550552
N-[1-[2-[2-(1,3-benzodioxole-5-carbothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylaziridin-1-ium-1-yl]-N-methylbenzenecarbothioamide (PubChem CID 91550552) has the molecular formula C21H23N4O5S3+ and a molecular weight of 507.64 g/mol. Its IUPAC name is N-[1-[2-[2-(1,3-benzodioxole-5-carbothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylaziridin-1-ium-1-yl]-N-methylbenzenecarbothioamide.
| Compound Name | N-[1-[2-[2-(1,3-benzodioxole-5-carbothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylaziridin-1-ium-1-yl]-N-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 91550552 |
| Molecular Formula | C21H23N4O5S3+ |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[1-[2-[2-(1,3-benzodioxole-5-carbothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylaziridin-1-ium-1-yl]-N-methylbenzenecarbothioamide |
| SMILES | CN(NC(=O)CS(=O)(=O)[N+]1(N(C)C(=S)c2ccccc2)CC1)C(=S)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22N4O5S3/c1-23(20(31)16-8-9-17-18(12-16)30-14-29-17)22-19(26)13-33(27,28)25(10-11-25)24(2)21(32)15-6-4-3-5-7-15/h3-9,12H,10-11,13-14H2,1-2H3/p+1 |
| InChIKey | WEIQEJASIVPFKL-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|