C16H16N2O5S — CID 108574611
N-[2-(benzenesulfonamido)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 108574611) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 108574611 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N2O5S/c19-16(12-6-7-14-15(10-12)23-11-22-14)17-8-9-18-24(20,21)13-4-2-1-3-5-13/h1-7,10,18H,8-9,11H2,(H,17,19) |
| InChIKey | PHOSVUXIRRSZDC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|