C13H18N4O3S4 — CID 87108726
methyl N-[[2-[2-(benzenecarbonothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylamino]-N-methylcarbamodithioate (PubChem CID 87108726) has the molecular formula C13H18N4O3S4 and a molecular weight of 406.58 g/mol. Its IUPAC name is methyl N-[[2-[2-(benzenecarbonothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylamino]-N-methylcarbamodithioate.
| Compound Name | methyl N-[[2-[2-(benzenecarbonothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylamino]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 87108726 |
| Molecular Formula | C13H18N4O3S4 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | methyl N-[[2-[2-(benzenecarbonothioyl)-2-methylhydrazinyl]-2-oxoethyl]sulfonylamino]-N-methylcarbamodithioate |
| SMILES | CSC(=S)N(C)NS(=O)(=O)CC(=O)NN(C)C(=S)c1ccccc1 |
| InChI | InChI=1S/C13H18N4O3S4/c1-16(12(21)10-7-5-4-6-8-10)14-11(18)9-24(19,20)15-17(2)13(22)23-3/h4-8,15H,9H2,1-3H3,(H,14,18) |
| InChIKey | OHYKUNSHTLNWQH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|