C14H16N4O3S5 — CID 87109063
N'-methyl-2-[[methyl(thiophene-3-carbothioyl)amino]sulfamoyl]-N'-(thiophene-3-carbothioyl)acetohydrazide (PubChem CID 87109063) has the molecular formula C14H16N4O3S5 and a molecular weight of 448.64 g/mol. Its IUPAC name is N'-methyl-2-[[methyl(thiophene-3-carbothioyl)amino]sulfamoyl]-N'-(thiophene-3-carbothioyl)acetohydrazide.
| Compound Name | N'-methyl-2-[[methyl(thiophene-3-carbothioyl)amino]sulfamoyl]-N'-(thiophene-3-carbothioyl)acetohydrazide |
|---|---|
| PubChem CID | 87109063 |
| Molecular Formula | C14H16N4O3S5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | N'-methyl-2-[[methyl(thiophene-3-carbothioyl)amino]sulfamoyl]-N'-(thiophene-3-carbothioyl)acetohydrazide |
| SMILES | CN(NC(=O)CS(=O)(=O)NN(C)C(=S)c1ccsc1)C(=S)c1ccsc1 |
| InChI | InChI=1S/C14H16N4O3S5/c1-17(13(22)10-3-5-24-7-10)15-12(19)9-26(20,21)16-18(2)14(23)11-4-6-25-8-11/h3-8,16H,9H2,1-2H3,(H,15,19) |
| InChIKey | WJJXIYRVRLPXRM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|