C10H16N2O3S2 — CID 71984168
2-(diethylsulfamoyl)-N-thiophen-3-ylacetamide (PubChem CID 71984168) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-(diethylsulfamoyl)-N-thiophen-3-ylacetamide.
| Compound Name | 2-(diethylsulfamoyl)-N-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 71984168 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-(diethylsulfamoyl)-N-thiophen-3-ylacetamide |
| SMILES | CCN(CC)S(=O)(=O)CC(=O)Nc1ccsc1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-3-12(4-2)17(14,15)8-10(13)11-9-5-6-16-7-9/h5-7H,3-4,8H2,1-2H3,(H,11,13) |
| InChIKey | HUVQAUYPPYSNCX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |