C8H9NO3S2 — CID 104570094
2-[2-oxo-2-(thiophen-3-ylamino)ethyl]sulfanylacetic acid (PubChem CID 104570094) has the molecular formula C8H9NO3S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[2-oxo-2-(thiophen-3-ylamino)ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-(thiophen-3-ylamino)ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104570094 |
| Molecular Formula | C8H9NO3S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2-[2-oxo-2-(thiophen-3-ylamino)ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1ccsc1 |
| InChI | InChI=1S/C8H9NO3S2/c10-7(4-14-5-8(11)12)9-6-1-2-13-3-6/h1-3H,4-5H2,(H,9,10)(H,11,12) |
| InChIKey | RNYWGMGAIGTYHB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |