C13H17NO6S — CID 115569395
2-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]sulfanylacetic acid (PubChem CID 115569395) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 115569395 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl]sulfanylacetic acid |
| SMILES | COc1cc(NC(=O)CSCC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO6S/c1-18-9-4-8(5-10(19-2)13(9)20-3)14-11(15)6-21-7-12(16)17/h4-5H,6-7H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | YVHPZGWBEGYSHC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |