C12H11N3O3S2 — CID 2739288
2-[2-oxo-2-[4-(thiadiazol-4-yl)anilino]ethyl]sulfanylacetic acid (PubChem CID 2739288) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-(thiadiazol-4-yl)anilino]ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[4-(thiadiazol-4-yl)anilino]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 2739288 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-[2-oxo-2-[4-(thiadiazol-4-yl)anilino]ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C12H11N3O3S2/c16-11(6-19-7-12(17)18)13-9-3-1-8(2-4-9)10-5-20-15-14-10/h1-5H,6-7H2,(H,13,16)(H,17,18) |
| InChIKey | GADODXDIAINKIX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |