C17H16N4O2S — CID 56826995
1-[(1S)-2-hydroxy-1-phenylethyl]-3-[4-(thiadiazol-4-yl)phenyl]urea (PubChem CID 56826995) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-[(1S)-2-hydroxy-1-phenylethyl]-3-[4-(thiadiazol-4-yl)phenyl]urea.
| Compound Name | 1-[(1S)-2-hydroxy-1-phenylethyl]-3-[4-(thiadiazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 56826995 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[(1S)-2-hydroxy-1-phenylethyl]-3-[4-(thiadiazol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O2S/c22-10-15(12-4-2-1-3-5-12)19-17(23)18-14-8-6-13(7-9-14)16-11-24-21-20-16/h1-9,11,15,22H,10H2,(H2,18,19,23)/t15-/m1/s1 |
| InChIKey | SHHPCZHCMAHYBJ-OAHLLOKOSA-N |
| XLogP | 3.06 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |