C10H12N2O5S2 — CID 113427691
2-[2-[(6-methylsulfonyl-3-pyridinyl)amino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 113427691) has the molecular formula C10H12N2O5S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-[(6-methylsulfonyl-3-pyridinyl)amino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(6-methylsulfonyl-3-pyridinyl)amino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 113427691 |
| Molecular Formula | C10H12N2O5S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[2-[(6-methylsulfonyl-3-pyridinyl)amino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CSCC(=O)O)cn1 |
| InChI | InChI=1S/C10H12N2O5S2/c1-19(16,17)9-3-2-7(4-11-9)12-8(13)5-18-6-10(14)15/h2-4H,5-6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | PSXXLYFSCJJUQW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |