C11H19Cl2N3O4S — CID 119854984
2-(2-methoxyethylamino)-N-(6-methylsulfonyl-3-pyridinyl)acetamide;dihydrochloride (PubChem CID 119854984) has the molecular formula C11H19Cl2N3O4S and a molecular weight of 360.26 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(6-methylsulfonyl-3-pyridinyl)acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(6-methylsulfonyl-3-pyridinyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119854984 |
| Molecular Formula | C11H19Cl2N3O4S |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(6-methylsulfonyl-3-pyridinyl)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(S(C)(=O)=O)nc1.Cl.Cl |
| InChI | InChI=1S/C11H17N3O4S.2ClH/c1-18-6-5-12-8-10(15)14-9-3-4-11(13-7-9)19(2,16)17;;/h3-4,7,12H,5-6,8H2,1-2H3,(H,14,15);2*1H |
| InChIKey | OTISRAJSMODKIM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|