C16H20Cl2FN3O3 — CID 119849115
N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119849115) has the molecular formula C16H20Cl2FN3O3 and a molecular weight of 392.26 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119849115 |
| Molecular Formula | C16H20Cl2FN3O3 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(Oc2ccc(F)cc2)nc1.Cl.Cl |
| InChI | InChI=1S/C16H18FN3O3.2ClH/c1-22-9-8-18-11-15(21)20-13-4-7-16(19-10-13)23-14-5-2-12(17)3-6-14;;/h2-7,10,18H,8-9,11H2,1H3,(H,20,21);2*1H |
| InChIKey | YINKVGMKSNPOMB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|