C21H20FN3O5S — CID 46389220
4-[[5-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide (PubChem CID 46389220) has the molecular formula C21H20FN3O5S and a molecular weight of 445.47 g/mol. Its IUPAC name is 4-[[5-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[[5-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 46389220 |
| Molecular Formula | C21H20FN3O5S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-[[5-[(4-fluorophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc(F)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H20FN3O5S/c1-29-13-12-23-21(26)15-2-7-18(8-3-15)30-20-11-6-17(14-24-20)25-31(27,28)19-9-4-16(22)5-10-19/h2-11,14,25H,12-13H2,1H3,(H,23,26) |
| InChIKey | IABYOABSAOMGNX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|