C21H18BrN3O4S — CID 46389249
4-[[5-[(4-bromophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-prop-2-enylbenzamide (PubChem CID 46389249) has the molecular formula C21H18BrN3O4S and a molecular weight of 488.36 g/mol. Its IUPAC name is 4-[[5-[(4-bromophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-prop-2-enylbenzamide.
| Compound Name | 4-[[5-[(4-bromophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 46389249 |
| Molecular Formula | C21H18BrN3O4S |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 4-[[5-[(4-bromophenyl)sulfonylamino]-2-pyridinyl]oxy]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc(Br)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H18BrN3O4S/c1-2-13-23-21(26)15-3-8-18(9-4-15)29-20-12-7-17(14-24-20)25-30(27,28)19-10-5-16(22)6-11-19/h2-12,14,25H,1,13H2,(H,23,26) |
| InChIKey | QOOZRSMHDUYFBH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|