C8H9N3O3S — CID 107587552
2-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]sulfanylacetic acid (PubChem CID 107587552) has the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 107587552 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-[2-oxo-2-(pyrimidin-5-ylamino)ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)Nc1cncnc1 |
| InChI | InChI=1S/C8H9N3O3S/c12-7(3-15-4-8(13)14)11-6-1-9-5-10-2-6/h1-2,5H,3-4H2,(H,11,12)(H,13,14) |
| InChIKey | UFTBRYSKGNRTGY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |