C20H26N6O3S3 — CID 46240119
3-ethyl-1-[[2-[[N-(ethylcarbamothioyl)anilino]sulfamoyl]acetyl]amino]-1-phenylthiourea (PubChem CID 46240119) has the molecular formula C20H26N6O3S3 and a molecular weight of 494.67 g/mol. Its IUPAC name is 3-ethyl-1-[[2-[[N-(ethylcarbamothioyl)anilino]sulfamoyl]acetyl]amino]-1-phenylthiourea.
| Compound Name | 3-ethyl-1-[[2-[[N-(ethylcarbamothioyl)anilino]sulfamoyl]acetyl]amino]-1-phenylthiourea |
|---|---|
| PubChem CID | 46240119 |
| Molecular Formula | C20H26N6O3S3 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 3-ethyl-1-[[2-[[N-(ethylcarbamothioyl)anilino]sulfamoyl]acetyl]amino]-1-phenylthiourea |
| SMILES | CCNC(=S)N(NC(=O)CS(=O)(=O)NN(C(=S)NCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N6O3S3/c1-3-21-19(30)25(16-11-7-5-8-12-16)23-18(27)15-32(28,29)24-26(20(31)22-4-2)17-13-9-6-10-14-17/h5-14,24H,3-4,15H2,1-2H3,(H,21,30)(H,22,31)(H,23,27) |
| InChIKey | BRAOTUOEYJTNJA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|