C15H26OSeSi — CID 15315455
trimethyl-[(2S,4R)-4-methylselanyl-4-phenylpentan-2-yl]oxysilane (PubChem CID 15315455) has the molecular formula C15H26OSeSi and a molecular weight of 329.42 g/mol. Its IUPAC name is trimethyl-[(2S,4R)-4-methylselanyl-4-phenylpentan-2-yl]oxysilane.
| Compound Name | trimethyl-[(2S,4R)-4-methylselanyl-4-phenylpentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 15315455 |
| Molecular Formula | C15H26OSeSi |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | trimethyl-[(2S,4R)-4-methylselanyl-4-phenylpentan-2-yl]oxysilane |
| SMILES | C[Se][C@](C)(C[C@H](C)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H26OSeSi/c1-13(16-18(4,5)6)12-15(2,17-3)14-10-8-7-9-11-14/h7-11,13H,12H2,1-6H3/t13-,15+/m0/s1 |
| InChIKey | ASXKVLLGKGSVAU-DZGCQCFKSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|