C12H18NO2PS — CID 23416261
(4S,5S)-2-ethoxy-3,4-dimethyl-5-phenyl-1,3,2λ5-thiazaphospholidine 2-oxide (PubChem CID 23416261) has the molecular formula C12H18NO2PS and a molecular weight of 271.32 g/mol. Its IUPAC name is (4S,5S)-2-ethoxy-3,4-dimethyl-5-phenyl-1,3,2λ5-thiazaphospholidine 2-oxide.
| Compound Name | (4S,5S)-2-ethoxy-3,4-dimethyl-5-phenyl-1,3,2λ5-thiazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 23416261 |
| Molecular Formula | C12H18NO2PS |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (4S,5S)-2-ethoxy-3,4-dimethyl-5-phenyl-1,3,2λ5-thiazaphospholidine 2-oxide |
| SMILES | CCOP1(=O)S[C@@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C12H18NO2PS/c1-4-15-16(14)13(3)10(2)12(17-16)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3/t10-,12+,16?/m0/s1 |
| InChIKey | LABDYZPFCNJYNE-FBQUQXAYSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|