C11H16O2PS+ — CID 101386724
2,2-diethoxy-3-phenylthiaphosphiran-2-ium (PubChem CID 101386724) has the molecular formula C11H16O2PS+ and a molecular weight of 243.29 g/mol. Its IUPAC name is 2,2-diethoxy-3-phenylthiaphosphiran-2-ium.
| Compound Name | 2,2-diethoxy-3-phenylthiaphosphiran-2-ium |
|---|---|
| PubChem CID | 101386724 |
| Molecular Formula | C11H16O2PS+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2,2-diethoxy-3-phenylthiaphosphiran-2-ium |
| SMILES | CCO[P+]1(OCC)SC1c1ccccc1 |
| InChI | InChI=1S/C11H16O2PS/c1-3-12-14(13-4-2)11(15-14)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3/q+1 |
| InChIKey | REWIWFWGRQXCGT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|