About 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane
1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane (PubChem CID 71245903) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane.
Molecular Properties
| Compound Name | 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane |
| PubChem CID | 71245903 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane |
| SMILES | CCOCC.NC1(O)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H13NO.C4H10O/c13-12(14)8-6-11(7-9-12)10-4-2-1-3-5-10;1-3-5-4-2/h1-9,11,14H,13H2;3-4H2,1-2H3 |
| InChIKey | LVMONTLIIQOIEM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane?
The IUPAC name of 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane (CID 71245903) is 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane.
What is the SMILES notation for 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane?
The canonical SMILES for 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane is CCOCC.NC1(O)C=CC(c2ccccc2)C=C1.
What is the InChIKey of 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane?
The InChIKey is LVMONTLIIQOIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.C4H10O/c13-12(14)8-6-11(7-9-12)10-4-2-1-3-5-10;1-3-5-4-2/h1-9,11,14H,13H2;3-4H2,1-2H3.
What are the key properties of 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane?
1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane has a molecular weight of 261.37 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-phenylcyclohexa-2,5-dien-1-ol;ethoxyethane is sourced from PubChem (CID 71245903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).