C15H16F2 — CID 23205704
3-(difluoromethyl)-3-ethyl-6-phenylcyclohexa-1,4-diene (PubChem CID 23205704) has the molecular formula C15H16F2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 3-(difluoromethyl)-3-ethyl-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3-(difluoromethyl)-3-ethyl-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 23205704 |
| Molecular Formula | C15H16F2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 3-(difluoromethyl)-3-ethyl-6-phenylcyclohexa-1,4-diene |
| SMILES | CCC1(C(F)F)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C15H16F2/c1-2-15(14(16)17)10-8-13(9-11-15)12-6-4-3-5-7-12/h3-11,13-14H,2H2,1H3 |
| InChIKey | RAQXUSOBJHTYQN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|