About 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine
2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine (PubChem CID 173372509) has the molecular formula C20H19F2N
and a molecular weight of 311.38 g/mol. Its IUPAC name is 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine.
Molecular Properties
| Compound Name | 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine |
| PubChem CID | 173372509 |
| Molecular Formula | C20H19F2N |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine |
| SMILES | CCCC1(c2ccc(F)nc2F)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C20H19F2N/c1-2-12-20(17-8-9-18(21)23-19(17)22)13-10-16(11-14-20)15-6-4-3-5-7-15/h3-11,13-14,16H,2,12H2,1H3 |
| InChIKey | CNTXDQQLZUHVCE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine?
The IUPAC name of 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine (CID 173372509) is 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine.
What is the SMILES notation for 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine?
The canonical SMILES for 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine is CCCC1(c2ccc(F)nc2F)C=CC(c2ccccc2)C=C1.
What is the InChIKey of 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine?
The InChIKey is CNTXDQQLZUHVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N/c1-2-12-20(17-8-9-18(21)23-19(17)22)13-10-16(11-14-20)15-6-4-3-5-7-15/h3-11,13-14,16H,2,12H2,1H3.
What are the key properties of 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine?
2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine has a molecular weight of 311.38 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-3-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)pyridine is sourced from PubChem (CID 173372509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).