C20H28O6 — CID 18793721
1-[2-[1-[2-(1-hydroxyethoxy)ethoxy]-4-phenylcyclohexa-2,5-dien-1-yl]oxyethoxy]ethanol (PubChem CID 18793721) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-[2-[1-[2-(1-hydroxyethoxy)ethoxy]-4-phenylcyclohexa-2,5-dien-1-yl]oxyethoxy]ethanol.
| Compound Name | 1-[2-[1-[2-(1-hydroxyethoxy)ethoxy]-4-phenylcyclohexa-2,5-dien-1-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 18793721 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[2-[1-[2-(1-hydroxyethoxy)ethoxy]-4-phenylcyclohexa-2,5-dien-1-yl]oxyethoxy]ethanol |
| SMILES | CC(O)OCCOC1(OCCOC(C)O)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C20H28O6/c1-16(21)23-12-14-25-20(26-15-13-24-17(2)22)10-8-19(9-11-20)18-6-4-3-5-7-18/h3-11,16-17,19,21-22H,12-15H2,1-2H3 |
| InChIKey | CAEUEGKFECKCAS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|