C19H20O — CID 67610479
4-(4-phenyl-1-prop-2-enylcyclohexa-2,5-dien-1-yl)but-3-yn-2-ol (PubChem CID 67610479) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-(4-phenyl-1-prop-2-enylcyclohexa-2,5-dien-1-yl)but-3-yn-2-ol.
| Compound Name | 4-(4-phenyl-1-prop-2-enylcyclohexa-2,5-dien-1-yl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 67610479 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-(4-phenyl-1-prop-2-enylcyclohexa-2,5-dien-1-yl)but-3-yn-2-ol |
| SMILES | C=CCC1(C#CC(C)O)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C19H20O/c1-3-12-19(13-9-16(2)20)14-10-18(11-15-19)17-7-5-4-6-8-17/h3-8,10-11,14-16,18,20H,1,12H2,2H3 |
| InChIKey | ZDCGDCPCFWMHNS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|