C16H15NS — CID 88597610
3-isothiocyanato-6-phenyl-3-prop-2-enylcyclohexa-1,4-diene (PubChem CID 88597610) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-isothiocyanato-6-phenyl-3-prop-2-enylcyclohexa-1,4-diene.
| Compound Name | 3-isothiocyanato-6-phenyl-3-prop-2-enylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 88597610 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-isothiocyanato-6-phenyl-3-prop-2-enylcyclohexa-1,4-diene |
| SMILES | C=CCC1(N=C=S)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C16H15NS/c1-2-10-16(17-13-18)11-8-15(9-12-16)14-6-4-3-5-7-14/h2-9,11-12,15H,1,10H2 |
| InChIKey | JJHREKNBUYQCSN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|