C12H10I2 — CID 18000337
3,3-diiodo-6-phenylcyclohexa-1,4-diene (PubChem CID 18000337) has the molecular formula C12H10I2 and a molecular weight of 408.02 g/mol. Its IUPAC name is 3,3-diiodo-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3,3-diiodo-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 18000337 |
| Molecular Formula | C12H10I2 |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 407.89 |
| IUPAC Name | 3,3-diiodo-6-phenylcyclohexa-1,4-diene |
| SMILES | IC1(I)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C12H10I2/c13-12(14)8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,11H |
| InChIKey | RBAWNTOWOPGAAM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|