C23H27N — CID 146303544
N-(1-tert-butyl-4-phenylcyclohexa-2,5-dien-1-yl)-2-methylaniline (PubChem CID 146303544) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is N-(1-tert-butyl-4-phenylcyclohexa-2,5-dien-1-yl)-2-methylaniline.
| Compound Name | N-(1-tert-butyl-4-phenylcyclohexa-2,5-dien-1-yl)-2-methylaniline |
|---|---|
| PubChem CID | 146303544 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-(1-tert-butyl-4-phenylcyclohexa-2,5-dien-1-yl)-2-methylaniline |
| SMILES | Cc1ccccc1NC1(C(C)(C)C)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C23H27N/c1-18-10-8-9-13-21(18)24-23(22(2,3)4)16-14-20(15-17-23)19-11-6-5-7-12-19/h5-17,20,24H,1-4H3 |
| InChIKey | NOWRFIDJHOOWNX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|