C28H28N2 — CID 134874635
(1S,2S)-N,N'-bis(2-methylphenyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 134874635) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is (1S,2S)-N,N'-bis(2-methylphenyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N'-bis(2-methylphenyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 134874635 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | (1S,2S)-N,N'-bis(2-methylphenyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | Cc1ccccc1N[C@@H](c1ccccc1)[C@@H](Nc1ccccc1C)c1ccccc1 |
| InChI | InChI=1S/C28H28N2/c1-21-13-9-11-19-25(21)29-27(23-15-5-3-6-16-23)28(24-17-7-4-8-18-24)30-26-20-12-10-14-22(26)2/h3-20,27-30H,1-2H3/t27-,28-/m0/s1 |
| InChIKey | OBPLTUDEICPZDH-NSOVKSMOSA-N |
| XLogP | 7.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |