C70H64N2 — CID 101435249
(1R,2R)-N,N'-bis[4-[3,5-bis(2,6-dimethylphenyl)phenyl]phenyl]-1,2-diphenylethane-1,2-diamine (PubChem CID 101435249) has the molecular formula C70H64N2 and a molecular weight of 933.30 g/mol. Its IUPAC name is (1R,2R)-N,N'-bis[4-[3,5-bis(2,6-dimethylphenyl)phenyl]phenyl]-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1R,2R)-N,N'-bis[4-[3,5-bis(2,6-dimethylphenyl)phenyl]phenyl]-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 101435249 |
| Molecular Formula | C70H64N2 |
| Molecular Weight | 933.30 g/mol |
| Exact Mass | 932.51 |
| IUPAC Name | (1R,2R)-N,N'-bis[4-[3,5-bis(2,6-dimethylphenyl)phenyl]phenyl]-1,2-diphenylethane-1,2-diamine |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccc(N[C@H](c3ccccc3)[C@H](Nc3ccc(-c4cc(-c5c(C)cccc5C)cc(-c5c(C)cccc5C)c4)cc3)c3ccccc3)cc2)cc(-c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C70H64N2/c1-45-19-15-20-46(2)65(45)59-39-57(40-60(43-59)66-47(3)21-16-22-48(66)4)53-31-35-63(36-32-53)71-69(55-27-11-9-12-28-55)70(56-29-13-10-14-30-56)72-64-37-33-54(34-38-64)58-41-61(67-49(5)23-17-24-50(67)6)44-62(42-58)68-51(7)25-18-26-52(68)8/h9-44,69-72H,1-8H3/t69-,70-/m1/s1 |
| InChIKey | WTRMSMXBXVTBTK-FAECOVEHSA-N |
| XLogP | 19.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.30 |
| LogP ≤ 5 | 19.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |