C29H28 — CID 140664576
5-(2,6-dimethylphenyl)-1,3-diphenyl-2-propan-2-ylbenzene (PubChem CID 140664576) has the molecular formula C29H28 and a molecular weight of 376.54 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-1,3-diphenyl-2-propan-2-ylbenzene.
| Compound Name | 5-(2,6-dimethylphenyl)-1,3-diphenyl-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 140664576 |
| Molecular Formula | C29H28 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-1,3-diphenyl-2-propan-2-ylbenzene |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccccc2)c(C(C)C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H28/c1-20(2)28-26(23-14-7-5-8-15-23)18-25(29-21(3)12-11-13-22(29)4)19-27(28)24-16-9-6-10-17-24/h5-20H,1-4H3 |
| InChIKey | JPVXWUAEHWUMRD-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |