C28H28N2S2 — CID 15533676
N,N'-bis(4-methylsulfanylphenyl)-1,2-diphenylethane-1,2-diamine (PubChem CID 15533676) has the molecular formula C28H28N2S2 and a molecular weight of 456.68 g/mol. Its IUPAC name is N,N'-bis(4-methylsulfanylphenyl)-1,2-diphenylethane-1,2-diamine.
| Compound Name | N,N'-bis(4-methylsulfanylphenyl)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 15533676 |
| Molecular Formula | C28H28N2S2 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N,N'-bis(4-methylsulfanylphenyl)-1,2-diphenylethane-1,2-diamine |
| SMILES | CSc1ccc(NC(c2ccccc2)C(Nc2ccc(SC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2S2/c1-31-25-17-13-23(14-18-25)29-27(21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)30-24-15-19-26(32-2)20-16-24/h3-20,27-30H,1-2H3 |
| InChIKey | YOCVQBPGUWBSEE-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |