About methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene
methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene (PubChem CID 159307359) has the molecular formula C24H34S2
and a molecular weight of 386.67 g/mol. Its IUPAC name is methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene.
Molecular Properties
| Compound Name | methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene |
| PubChem CID | 159307359 |
| Molecular Formula | C24H34S2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene |
| SMILES | C.C.C.CSC(c1ccccc1)c1ccccc1.CSc1ccccc1 |
| InChI | InChI=1S/C14H14S.C7H8S.3CH4/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-8-7-5-3-2-4-6-7;;;/h2-11,14H,1H3;2-6H,1H3;3*1H4 |
| InChIKey | LCBXAXJYYZPMEQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene?
The IUPAC name of methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene (CID 159307359) is methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene.
What is the SMILES notation for methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene?
The canonical SMILES for methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene is C.C.C.CSC(c1ccccc1)c1ccccc1.CSc1ccccc1.
What is the InChIKey of methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene?
The InChIKey is LCBXAXJYYZPMEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.C7H8S.3CH4/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-8-7-5-3-2-4-6-7;;;/h2-11,14H,1H3;2-6H,1H3;3*1H4.
What are the key properties of methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene?
methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene has a molecular weight of 386.67 g/mol, XLogP of 8.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methylsulfanylbenzene;[methylsulfanyl(phenyl)methyl]benzene is sourced from PubChem (CID 159307359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).