C14H13Cl — CID 70019040
3-chloro-3-ethenyl-6-phenylcyclohexa-1,4-diene (PubChem CID 70019040) has the molecular formula C14H13Cl and a molecular weight of 216.71 g/mol. Its IUPAC name is 3-chloro-3-ethenyl-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3-chloro-3-ethenyl-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 70019040 |
| Molecular Formula | C14H13Cl |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-chloro-3-ethenyl-6-phenylcyclohexa-1,4-diene |
| SMILES | C=CC1(Cl)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C14H13Cl/c1-2-14(15)10-8-13(9-11-14)12-6-4-3-5-7-12/h2-11,13H,1H2 |
| InChIKey | RCTPNSPHJUMKTN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|