C14H11ClO4 — CID 126737100
2-chloro-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid (PubChem CID 126737100) has the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. Its IUPAC name is 2-chloro-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid.
| Compound Name | 2-chloro-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 126737100 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-chloro-4-phenylcyclohexa-2,5-diene-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)C=CC(c2ccccc2)C=C1Cl |
| InChI | InChI=1S/C14H11ClO4/c15-11-8-10(9-4-2-1-3-5-9)6-7-14(11,12(16)17)13(18)19/h1-8,10H,(H,16,17)(H,18,19) |
| InChIKey | KZZDQOKUPCKDQV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|