C16H18N2O4 — CID 137379360
[1-(2-aminoacetyl)oxy-4-phenylcyclohexa-2,5-dien-1-yl] 2-aminoacetate (PubChem CID 137379360) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [1-(2-aminoacetyl)oxy-4-phenylcyclohexa-2,5-dien-1-yl] 2-aminoacetate.
| Compound Name | [1-(2-aminoacetyl)oxy-4-phenylcyclohexa-2,5-dien-1-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 137379360 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [1-(2-aminoacetyl)oxy-4-phenylcyclohexa-2,5-dien-1-yl] 2-aminoacetate |
| SMILES | NCC(=O)OC1(OC(=O)CN)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C16H18N2O4/c17-10-14(19)21-16(22-15(20)11-18)8-6-13(7-9-16)12-4-2-1-3-5-12/h1-9,13H,10-11,17-18H2 |
| InChIKey | PWRUDHOMUKMKSQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|