C18H15ClO3S — CID 67809223
1-(4-chlorophenyl)sulfonyl-4-phenylcyclohexa-2,5-dien-1-ol (PubChem CID 67809223) has the molecular formula C18H15ClO3S and a molecular weight of 346.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-phenylcyclohexa-2,5-dien-1-ol.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-phenylcyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 67809223 |
| Molecular Formula | C18H15ClO3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-phenylcyclohexa-2,5-dien-1-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1(O)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C18H15ClO3S/c19-16-6-8-17(9-7-16)23(21,22)18(20)12-10-15(11-13-18)14-4-2-1-3-5-14/h1-13,15,20H |
| InChIKey | OZFIRAWDULDFPC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|