C18H16ClNO4S — CID 15994572
3-acetyl-1-(4-chlorophenyl)sulfonyl-4-phenylpyrrolidin-2-one (PubChem CID 15994572) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-acetyl-1-(4-chlorophenyl)sulfonyl-4-phenylpyrrolidin-2-one.
| Compound Name | 3-acetyl-1-(4-chlorophenyl)sulfonyl-4-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15994572 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 3-acetyl-1-(4-chlorophenyl)sulfonyl-4-phenylpyrrolidin-2-one |
| SMILES | CC(=O)C1C(=O)N(S(=O)(=O)c2ccc(Cl)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-12(21)17-16(13-5-3-2-4-6-13)11-20(18(17)22)25(23,24)15-9-7-14(19)8-10-15/h2-10,16-17H,11H2,1H3 |
| InChIKey | OFHSFRHZKINEAB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|