C22H20Cl2N2O2S — CID 142664123
(4S)-3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-1-methyl-4-phenylpyrazolidine (PubChem CID 142664123) has the molecular formula C22H20Cl2N2O2S and a molecular weight of 447.39 g/mol. Its IUPAC name is (4S)-3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-1-methyl-4-phenylpyrazolidine.
| Compound Name | (4S)-3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-1-methyl-4-phenylpyrazolidine |
|---|---|
| PubChem CID | 142664123 |
| Molecular Formula | C22H20Cl2N2O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (4S)-3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfonyl-1-methyl-4-phenylpyrazolidine |
| SMILES | CN1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O2S/c1-25-15-21(16-5-3-2-4-6-16)22(17-7-9-18(23)10-8-17)26(25)29(27,28)20-13-11-19(24)12-14-20/h2-14,21-22H,15H2,1H3/t21-,22?/m1/s1 |
| InChIKey | XQNSQZYGGOXXEK-ZMFCMNQTSA-N |
| XLogP | 5.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |