C16H18ClNO4S — CID 59679471
2-acetyl-9-(4-chlorophenyl)sulfonyl-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 59679471) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is 2-acetyl-9-(4-chlorophenyl)sulfonyl-9-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | 2-acetyl-9-(4-chlorophenyl)sulfonyl-9-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 59679471 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-acetyl-9-(4-chlorophenyl)sulfonyl-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | CC(=O)C1C(=O)CC2CCCC1N2S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H18ClNO4S/c1-10(19)16-14-4-2-3-12(9-15(16)20)18(14)23(21,22)13-7-5-11(17)6-8-13/h5-8,12,14,16H,2-4,9H2,1H3 |
| InChIKey | IOQYPKSKLLGAOP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|