C16H13ClN2O5S — CID 14822936
2-[4-(4-chlorophenyl)sulfonyl-2-oxo-3H-quinoxalin-1-yl]acetic acid (PubChem CID 14822936) has the molecular formula C16H13ClN2O5S and a molecular weight of 380.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonyl-2-oxo-3H-quinoxalin-1-yl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonyl-2-oxo-3H-quinoxalin-1-yl]acetic acid |
|---|---|
| PubChem CID | 14822936 |
| Molecular Formula | C16H13ClN2O5S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonyl-2-oxo-3H-quinoxalin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)CN(S(=O)(=O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C16H13ClN2O5S/c17-11-5-7-12(8-6-11)25(23,24)19-9-15(20)18(10-16(21)22)13-3-1-2-4-14(13)19/h1-8H,9-10H2,(H,21,22) |
| InChIKey | NGHZVUSXBDSZED-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |