C15H12ClNO2S3 — CID 1365840
(4S)-3-(4-chlorophenyl)sulfonyl-4-phenyl-1,3-thiazolidine-2-thione (PubChem CID 1365840) has the molecular formula C15H12ClNO2S3 and a molecular weight of 369.92 g/mol. Its IUPAC name is (4S)-3-(4-chlorophenyl)sulfonyl-4-phenyl-1,3-thiazolidine-2-thione.
| Compound Name | (4S)-3-(4-chlorophenyl)sulfonyl-4-phenyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 1365840 |
| Molecular Formula | C15H12ClNO2S3 |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | (4S)-3-(4-chlorophenyl)sulfonyl-4-phenyl-1,3-thiazolidine-2-thione |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1C(=S)SC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H12ClNO2S3/c16-12-6-8-13(9-7-12)22(18,19)17-14(10-21-15(17)20)11-4-2-1-3-5-11/h1-9,14H,10H2/t14-/m1/s1 |
| InChIKey | VEUYKJCFTBNWPC-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|