C14H17N — CID 173163719
N,N-dimethyl-4-phenylcyclohexa-2,5-dien-1-amine (PubChem CID 173163719) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N,N-dimethyl-4-phenylcyclohexa-2,5-dien-1-amine.
| Compound Name | N,N-dimethyl-4-phenylcyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 173163719 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N,N-dimethyl-4-phenylcyclohexa-2,5-dien-1-amine |
| SMILES | CN(C)C1C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C14H17N/c1-15(2)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11,13-14H,1-2H3 |
| InChIKey | IRWLFSDLLKZREE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|