About 2-phenyl-2H-indene
2-phenyl-2H-indene (PubChem CID 24940237) has the molecular formula C15H12
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-phenyl-2H-indene.
Molecular Properties
| Compound Name | 2-phenyl-2H-indene |
| PubChem CID | 24940237 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-phenyl-2H-indene |
| SMILES | C1=c2ccccc2=CC1c1ccccc1 |
| InChI | InChI=1S/C15H12/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15/h1-11,15H |
| InChIKey | RLGLYIWPZJNCEA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenyl-2H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2H-indene?
The IUPAC name of 2-phenyl-2H-indene (CID 24940237) is 2-phenyl-2H-indene.
What is the SMILES notation for 2-phenyl-2H-indene?
The canonical SMILES for 2-phenyl-2H-indene is C1=c2ccccc2=CC1c1ccccc1.
What is the InChIKey of 2-phenyl-2H-indene?
The InChIKey is RLGLYIWPZJNCEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15/h1-11,15H.
What are the key properties of 2-phenyl-2H-indene?
2-phenyl-2H-indene has a molecular weight of 192.26 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2H-indene is sourced from PubChem (CID 24940237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).